
CAS 10076-57-0
:1,1′-[(1-Methylethylidene)bis(oxy)]bis[pentane]
Description:
1,1′-[(1-Methylethylidene)bis(oxy)]bis[pentane], with CAS number 10076-57-0, is a chemical compound characterized by its structure, which includes a central bis(ether) linkage and two pentane chains. This compound is typically classified as a type of ether due to the presence of ether linkages in its molecular structure. It is a colorless to pale yellow liquid at room temperature and is generally insoluble in water but soluble in organic solvents. The presence of the isopropylidene group contributes to its hydrophobic characteristics. Its molecular structure suggests potential applications in various fields, including as a solvent or in the formulation of specialty chemicals. Additionally, the compound may exhibit moderate volatility and varying degrees of stability depending on environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique structure and properties make it of interest in both industrial and research applications.
Formula:C13H28O2
InChI:InChI=1S/C13H28O2/c1-5-7-9-11-14-13(3,4)15-12-10-8-6-2/h5-12H2,1-4H3
InChI key:InChIKey=NWYYISOYSZWERS-UHFFFAOYSA-N
SMILES:O(C(OCCCCC)(C)C)CCCCC
Synonyms:- 1,1′-[(1-Methylethylidene)bis(oxy)]bis[pentane]
- 2,2-Bis(pentyloxy)propane
- Acetone, dipentyl acetal
- Propane, 2,2-bis(pentyloxy)-
- Pentane, 1,1′-[(1-methylethylidene)bis(oxy)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
