CAS 10077-97-1

ethyl (1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)carbamate

Description:

Ethyl (1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)carbamate, with the CAS number 10077-97-1, is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a carbamate functional group. This compound typically exhibits properties associated with both pyrazole derivatives and carbamates, such as potential biological activity and solubility in organic solvents. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and interaction with other molecules. Ethyl carbamates are often noted for their applications in medicinal chemistry, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. The compound may also exhibit specific pharmacological properties, making it of interest in drug development. Its stability, reactivity, and solubility can vary based on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and industrial applications.

Formula: C₁₄H₁₇N₃O₃

InChI: InChI=1/C14H17N3O3/c1-4-20-14(19)15-12-10(2)16(3)17(13(12)18)11-8-6-5-7-9-11/h5-9H,4H2,1-3H3,(H,15,19)

SMILES: CCOC(=Nc1c(C)n(C)n(c2ccccc2)c1=O)O

Synonyms:

• carbamic acid, N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-, ethyl ester