CymitQuimica logo

CAS 100784-26-7

:

Ethyl 3-chloro-5-Amino sulfonyl-1-methylpyrazole-4-carboxylate

Description:
Ethyl 3-chloro-5-amino sulfonyl-1-methylpyrazole-4-carboxylate is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a carboxylate group, and a sulfonyl moiety. The presence of the chloro and amino groups contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its sulfonyl group can enhance its stability and influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents with anti-inflammatory or antimicrobial properties. As with many sulfonyl-containing compounds, it may also exhibit unique electronic properties that could be exploited in various chemical reactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H10ClN3O4S
InChI:InChI=1/C7H10ClN3O4S/c1-3-15-7(12)4-5(8)10-11(2)6(4)16(9,13)14/h3H2,1-2H3,(H2,9,13,14)
SMILES:CCOC(=O)c1c(Cl)nn(C)c1S(=O)(=O)N
Synonyms:
  • 1H-pyrazole-4-carboxylic acid, 5-(aminosulfonyl)-3-chloro-1-methyl-, ethyl ester
  • Ethyl 3-chloro-1-methyl-5-sulfamoyl-1H-pyrazole-4-carboxylate
  • 3-Chloro-1-Methyl-5-Sulfamoyl-1H-Pyrazole-4-Carboxylic Acid Methyl Ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.