CAS 1007875-84-4

2,3-Dimethylimidazo[2,1-b]thiazole-5-carboxylic acid

Description:

2,3-Dimethylimidazo[2,1-b]thiazole-5-carboxylic acid is a heterocyclic compound characterized by its imidazole and thiazole rings, which contribute to its unique chemical properties. This compound features two methyl groups at the 2 and 3 positions of the imidazole ring and a carboxylic acid functional group at the 5 position of the thiazole ring. It is known for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as compounds with similar structures have been implicated in the formation of DNA adducts. The presence of both nitrogen and sulfur atoms in its structure enhances its reactivity and solubility in various solvents. Additionally, the compound's molecular structure allows for various synthetic modifications, making it of interest in medicinal chemistry and research. Its CAS number, 1007875-84-4, is a unique identifier that facilitates the tracking and study of this specific chemical in scientific literature and databases.

Formula: C₈H₈N₂O₂S

InChI: InChI=1S/C8H8N2O2S/c1-4-5(2)13-8-9-3-6(7(11)12)10(4)8/h3H,1-2H3,(H,11,12)

InChI key: InChIKey=OMIYPNSNIFYHLI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(SC(C)=C2C)=NC1

Synonyms:

• 2,3-Dimethylimidazo[2,1-b]thiazole-5-carboxylic acid
• Imidazo[2,1-b]thiazole-5-carboxylic acid, 2,3-dimethyl-
• 2,3-Dimethylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

2,3-Dimethylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

CAS: 1007875-84-4

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-HQB87584