CAS 1007878-75-2

α-(Dimethylamino)-2-pyridineacetic acid

Description:

α-(Dimethylamino)-2-pyridineacetic acid, with the CAS number 1007878-75-2, is a chemical compound characterized by its pyridine and acetic acid functional groups. It features a dimethylamino group, which contributes to its basicity and potential for forming salts. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. Its structure allows for various interactions, making it useful in medicinal chemistry and as a potential ligand in coordination chemistry. The compound may exhibit biological activity, which can be attributed to its ability to interact with biological targets, although specific pharmacological properties would require further investigation. Safety data should be consulted for handling and usage, as with any chemical substance. Overall, α-(Dimethylamino)-2-pyridineacetic acid is of interest in both synthetic and pharmaceutical chemistry due to its unique structural features and potential applications.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-11(2)8(9(12)13)7-5-3-4-6-10-7/h3-6,8H,1-2H3,(H,12,13)

InChI key: InChIKey=FKDQUOQSYLHCDG-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N(C)C)C1=CC=CC=N1

Synonyms:

• α-(Dimethylamino)-2-pyridineacetic acid
• 2-Pyridineacetic acid, α-(dimethylamino)-
• 2-(Dimethylamino)-2-(pyridin-2-yl)acetic acid