CymitQuimica logo

CAS 1007878-82-1

:

α-(Dimethylamino)-3-(trifluoromethyl)benzeneacetic acid

Description:
α-(Dimethylamino)-3-(trifluoromethyl)benzeneacetic acid, identified by its CAS number 1007878-82-1, is an organic compound characterized by the presence of a dimethylamino group and a trifluoromethyl group attached to a benzene ring. This compound features an acetic acid functional group, which contributes to its acidic properties. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it potentially useful in pharmaceutical applications. The dimethylamino group can influence the compound's basicity and reactivity, allowing for various interactions in biological systems. In terms of physical properties, it is likely to be a solid or liquid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid group. The compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H12F3NO2
InChI:InChI=1S/C11H12F3NO2/c1-15(2)9(10(16)17)7-4-3-5-8(6-7)11(12,13)14/h3-6,9H,1-2H3,(H,16,17)
InChI key:InChIKey=HAPWJZPZKWIJFS-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=CC(C(F)(F)F)=CC=C1
Synonyms:
  • Benzeneacetic acid, α-(dimethylamino)-3-(trifluoromethyl)-
  • 2-(Dimethylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid
  • α-(Dimethylamino)-3-(trifluoromethyl)benzeneacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.