CAS 1007878-95-6

α-(Dimethylamino)-2-methyl-4-thiazoleacetic acid

Description:

α-(Dimethylamino)-2-methyl-4-thiazoleacetic acid, identified by its CAS number 1007878-95-6, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound typically exhibits properties associated with amino acids, including the presence of both acidic and basic functional groups, allowing it to participate in various biochemical interactions. The dimethylamino group enhances its solubility in polar solvents and may influence its pharmacological properties. Additionally, the thiazole moiety is known for its role in various biological processes and can be involved in enzyme interactions. The compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its stability, reactivity, and interaction with other molecules can vary based on environmental conditions such as pH and temperature. As with many thiazole derivatives, it may also possess antimicrobial or anti-inflammatory properties, making it of interest in drug discovery and development.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1S/C8H12N2O2S/c1-5-9-6(4-13-5)7(8(11)12)10(2)3/h4,7H,1-3H3,(H,11,12)

InChI key: InChIKey=HUEQSBCPARHWPL-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N(C)C)C=1N=C(C)SC1

Synonyms:

• 2-(Dimethylamino)-2-(2-methylthiazol-4-yl)acetic acid
• α-(Dimethylamino)-2-methyl-4-thiazoleacetic acid
• 2-(Dimethylamino)-2-(2-methyl-1,3-thiazol-4-yl)acetic acid
• 4-Thiazoleacetic acid, α-(dimethylamino)-2-methyl-