
CAS 1007879-26-6
:Ethyl α-bromo-6-chloro-3-pyridineacetate
Description:
Ethyl α-bromo-6-chloro-3-pyridineacetate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of both bromine and chlorine substituents on the pyridine ring indicates that this compound may exhibit unique reactivity patterns, particularly in nucleophilic substitution reactions. The ethyl ester functional group contributes to its solubility in organic solvents and may influence its biological activity. This compound is likely to be of interest in medicinal chemistry and synthetic organic chemistry due to its potential as an intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics (NMR, IR, MS), would be essential for identifying and characterizing the compound in laboratory settings. Additionally, safety data should be consulted, as halogenated compounds can pose health and environmental risks. Overall, Ethyl α-bromo-6-chloro-3-pyridineacetate represents a versatile building block in chemical synthesis.
Formula:C9H9BrClNO2
InChI:InChI=1S/C9H9BrClNO2/c1-2-14-9(13)8(10)6-3-4-7(11)12-5-6/h3-5,8H,2H2,1H3
InChI key:InChIKey=UNFTXRWJRCGTIY-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(Br)C=1C=CC(Cl)=NC1
Synonyms:- 3-Pyridineacetic acid, α-bromo-6-chloro-, ethyl ester
- Ethyl α-bromo-6-chloro-3-pyridineacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.