CAS 1007880-13-8: (αR)-α-[(Methoxycarbonyl)amino]cyclopropaneacetic acid

Description:(αR)-α-[(Methoxycarbonyl)amino]cyclopropaneacetic acid, with the CAS number 1007880-13-8, is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring. This compound features an amino group and a methoxycarbonyl group, contributing to its potential as an amino acid derivative. The presence of the methoxycarbonyl group indicates that it can participate in various chemical reactions, such as esterification or amidation, making it versatile in synthetic organic chemistry. The specific stereochemistry denoted by (αR) suggests that it has a defined spatial arrangement, which can influence its biological activity and interactions with other molecules. This compound may exhibit properties typical of amino acids, such as solubility in polar solvents and the ability to form hydrogen bonds. Its unique structure may also allow it to act as a building block in the synthesis of more complex molecules, particularly in pharmaceutical applications. Further studies would be necessary to fully elucidate its reactivity and potential uses in various chemical contexts.

Formula:C₇H₁₁NO₄

InChI:InChI=1S/C7H11NO4/c1-12-7(11)8-5(6(9)10)4-2-3-4/h4-5H,2-3H2,1H3,(H,8,11)(H,9,10)/t5-/m1/s1

InChI key:InChIKey=ZTGALQVOXKWCNJ-RXMQYKEDSA-N

SMILES:O=C(OC)NC(C(=O)O)C1CC1

Synonyms:
(R)-2-Cyclopropyl-2-((methoxycarbonyl)amino)acetic acid
(αR)-α-[(Methoxycarbonyl)amino]cyclopropaneacetic acid
(2R)-2-Cyclopropyl-2-[(methoxycarbonyl)amino]acetic acid
Cyclopropaneacetic acid, α-[(methoxycarbonyl)amino]-, (αR)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	(R)-2-Cyclopropyl-2-((methoxycarbonyl)amino)acetic acid REF: 10-F621167CAS: 1007880-13-8	95%	- - -	Discontinued product
	(R)-2-Cyclopropyl-2-((methoxycarbonyl)amino)acetic acid REF: 3D-HQB88013CAS: 1007880-13-8	Min. 95%	- - -	Discontinued product