
CAS 1007880-27-4
:1-[(Methoxycarbonyl)amino]cyclobutanecarboxylic acid
Description:
1-[(Methoxycarbonyl)amino]cyclobutanecarboxylic acid, identified by its CAS number 1007880-27-4, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. This compound features both a methoxycarbonyl group and an amino group, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, while the methoxycarbonyl group suggests potential for esterification or further functionalization. The amino group can engage in hydrogen bonding and may influence the compound's solubility and interaction with biological systems. Overall, this compound's structural features make it a candidate for various chemical reactions, including coupling reactions and modifications to enhance pharmacological properties. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied or utilized.
Formula:C7H11NO4
InChI:InChI=1S/C7H11NO4/c1-12-6(11)8-7(5(9)10)3-2-4-7/h2-4H2,1H3,(H,8,11)(H,9,10)
InChI key:InChIKey=VNQNIPLOFMXZNM-UHFFFAOYSA-N
SMILES:N(C(OC)=O)C1(C(O)=O)CCC1
Synonyms:- 1-[(Methoxycarbonyl)amino]cyclobutane-1-carboxylic acid
- Cyclobutanecarboxylic acid, 1-[(methoxycarbonyl)amino]-
- 1-[(Methoxycarbonyl)amino]cyclobutanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.