CymitQuimica logo

CAS 1007881-23-3

:

N-(Methoxycarbonyl)-O-methyl-L-homoserine

Description:
N-(Methoxycarbonyl)-O-methyl-L-homoserine, identified by its CAS number 1007881-23-3, is an amino acid derivative characterized by the presence of both a methoxycarbonyl group and a methoxy group. This compound features a homoserine backbone, which is an amino acid that contains a hydroxyl group, contributing to its solubility in polar solvents. The methoxycarbonyl group enhances its reactivity and can participate in various chemical reactions, making it useful in synthetic organic chemistry. The O-methyl substitution indicates that the hydroxyl group of homoserine is methylated, which can influence the compound's biological activity and interaction with enzymes or receptors. Typically, such derivatives are of interest in pharmaceutical research and biochemical applications due to their potential roles in metabolic pathways or as intermediates in the synthesis of more complex molecules. The compound's stability, solubility, and reactivity are essential characteristics that determine its utility in various chemical and biological contexts.
Formula:C7H13NO5
InChI:InChI=1S/C7H13NO5/c1-12-4-3-5(6(9)10)8-7(11)13-2/h5H,3-4H2,1-2H3,(H,8,11)(H,9,10)/t5-/m0/s1
InChI key:InChIKey=FNGKZNPMMOWQPF-YFKPBYRVSA-N
SMILES:[C@H](NC(OC)=O)(CCOC)C(O)=O
Synonyms:
  • N-(Methoxycarbonyl)-O-methyl-L-homoserine
  • L-Homoserine, N-(methoxycarbonyl)-O-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.