CymitQuimica logo

CAS 1007912-98-2

:

α-(Dimethylamino)-4-pyridineacetic acid

Description:
α-(Dimethylamino)-4-pyridineacetic acid, also known by its CAS number 1007912-98-2, is a chemical compound characterized by its pyridine ring structure, which is substituted with a dimethylamino group and an acetic acid moiety. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the dimethylamino group and the carboxylic acid group, respectively. It is soluble in polar solvents, which is common for compounds containing both nitrogen and carboxylic acid groups. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and its utility in various organic synthesis reactions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. As with many organic compounds, handling should be done with care, observing appropriate safety protocols to mitigate any risks associated with its use.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-11(2)8(9(12)13)7-3-5-10-6-4-7/h3-6,8H,1-2H3,(H,12,13)
InChI key:InChIKey=IARSHNWRCPTAHF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C=1C=CN=CC1
Synonyms:
  • 2-(Dimethylamino)-2-(pyridin-4-yl)acetic acid
  • 4-Pyridineacetic acid, α-(dimethylamino)-
  • α-(Dimethylamino)-4-pyridineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.