
CAS 1007913-00-9
:α-(Dimethylamino)-3-quinolineacetic acid
Description:
α-(Dimethylamino)-3-quinolineacetic acid, identified by its CAS number 1007913-00-9, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound. This substance features a dimethylamino group, contributing to its basicity and potential for forming salts. The presence of the acetic acid moiety indicates that it can participate in acid-base reactions, making it a versatile compound in various chemical contexts. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The quinoline framework is known for its role in medicinal chemistry, often associated with antimicrobial and antimalarial properties. In terms of solubility, such compounds may exhibit varying degrees of solubility in polar and non-polar solvents, influenced by the functional groups present. Overall, α-(Dimethylamino)-3-quinolineacetic acid represents a class of compounds with significant potential in both research and application within the fields of chemistry and pharmacology.
Formula:C13H14N2O2
InChI:InChI=1S/C13H14N2O2/c1-15(2)12(13(16)17)10-7-9-5-3-4-6-11(9)14-8-10/h3-8,12H,1-2H3,(H,16,17)
InChI key:InChIKey=QVPBVAKLIWUEEJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N(C)C)C1=CC2=C(N=C1)C=CC=C2
Synonyms:- α-(Dimethylamino)-3-quinolineacetic acid
- 3-Quinolineacetic acid, α-(dimethylamino)-
- 2-(Dimethylamino)-2-(quinolin-3-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.