CAS 1007913-07-6

(αS)-α-[(Methoxycarbonyl)amino]-1-methyl-1H-imidazole-2-propanoic acid

Description:

(αS)-α-[(Methoxycarbonyl)amino]-1-methyl-1H-imidazole-2-propanoic acid is a chemical compound characterized by its unique structure, which includes an imidazole ring and a propanoic acid moiety. This compound features a methoxycarbonyl group, which contributes to its properties as an amino acid derivative. The presence of the methyl group on the imidazole ring influences its steric and electronic characteristics, potentially affecting its reactivity and interactions with biological systems. As an amino acid analog, it may exhibit properties relevant to biochemical pathways, including potential roles in enzyme inhibition or modulation. The specific stereochemistry indicated by the (αS) designation suggests that it has a particular spatial arrangement, which can be crucial for its biological activity. This compound is likely to be soluble in polar solvents due to the presence of both polar functional groups and the carboxylic acid, making it suitable for various applications in medicinal chemistry and biochemistry. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.

Formula: C₉H₁₃N₃O₄

InChI: InChI=1S/C9H13N3O4/c1-12-4-3-10-7(12)5-6(8(13)14)11-9(15)16-2/h3-4,6H,5H2,1-2H3,(H,11,15)(H,13,14)/t6-/m0/s1

InChI key: InChIKey=RCPZNLMYLXPYEJ-LURJTMIESA-N

SMILES: C([C@H](NC(OC)=O)C(O)=O)C=1N(C)C=CN1

Synonyms:

• 1H-Imidazole-2-propanoic acid, α-[(methoxycarbonyl)amino]-1-methyl-, (αS)-
• (αS)-α-[(Methoxycarbonyl)amino]-1-methyl-1H-imidazole-2-propanoic acid
• (S)-2-((Methoxycarbonyl)amino)-3-(1-methyl-1H-imidazol-2-yl)propanoic acid
• (2S)-2-[(Methoxycarbonyl)amino]-3-(1-methyl-1H-imidazol-2-yl)propanoic acid