CAS 100796-22-3

1-FURFURYL-3-(P-TOLYLSULFONYL)-UREA

Description:

1-Furfury-3-(p-tolylsulfonyl)-urea, identified by its CAS number 100796-22-3, is a chemical compound that features a urea functional group substituted with a furfuryl and a p-tolylsulfonyl moiety. This compound is characterized by its unique structural components, which contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. The furfuryl group, derived from furan, imparts aromatic properties and may enhance the compound's reactivity and solubility. The p-tolylsulfonyl group adds a sulfonyl functional group, which can influence the compound's electronic properties and interactions with biological targets. Typically, compounds of this nature may exhibit moderate to high stability under standard conditions, but their reactivity can vary based on environmental factors such as pH and temperature. Additionally, the presence of both aromatic and heterocyclic structures suggests potential for diverse biological activity, making it a subject of interest for further research in medicinal chemistry and related disciplines.

Formula: C₁₃H₁₄N₂O₄S

InChI: InChI=1/C13H14N2O4S/c1-10-4-6-12(7-5-10)20(17,18)15-13(16)14-9-11-3-2-8-19-11/h2-8H,9H2,1H3,(H2,14,15,16)

SMILES: Cc1ccc(cc1)S(=O)(=O)NC(=NCc1ccco1)O

Synonyms:

• 2-{[({[(4-Methylphenyl)Sulfonyl]Amino}Carbonyl)Amino]Methyl}Furan
• benzenesulfonamide, N-[[(2-furanylmethyl)amino]carbonyl]-4-methyl-
• N-[(2-furylmethyl)carbamoyl]-4-methylbenzenesulfonamide
• N-[(furan-2-ylmethyl)carbamoyl]-4-methylbenzenesulfonamide