CAS 1008-30-6: 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one
Description:2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one, with the CAS number 1008-30-6, is a heterocyclic organic compound characterized by its triazole ring structure. This compound features a phenyl group attached to the triazole, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the triazole moiety imparts potential biological activity, making it of interest in pharmaceutical and agricultural applications. Its structure allows for various chemical reactions, including substitution and oxidation, which can be exploited in synthetic chemistry. Additionally, the compound may exhibit specific interactions with biological targets, leading to potential uses in drug development or as a fungicide. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one is a versatile compound with significant implications in various fields of research.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c12-8-10-9-6-11(8)7-4-2-1-3-5-7/h1-6H,(H,10,12)
InChI key:InChIKey=UYVVGXZLFHZTKT-UHFFFAOYSA-N
SMILES:O=C1NN=CN1C=2C=CC=CC2
- Synonyms:
- 3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl-
- 4-phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one
- NSC 93434
- Δ<sup>2</sup>-1,2,4-Triazolin-5-one, 4-phenyl-

3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl-
Ref: IN-DA0002WL
1g | 193.00 € | ||
100mg | 56.00 € | ||
250mg | 88.00 € |

4-phenyl-4,5-dihydro-1H-1,2,4-triazol-5-one
Ref: 10-F601398
1g | 155.00 € | ||
5g | 543.00 € | ||
10g | 1,017.00 € | ||
2.5g | 326.00 € | ||
100mg | 80.00 € | ||
250mg | 104.00 € | ||
500mg | 117.00 € |

2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one
Ref: 54-OR15507
Undefined size | To inquire |

4-Phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one
Ref: 3D-BAA00830
5g | 1,072.00 € | ||
500mg | 410.00 € |