CAS 1008-30-6: 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one

Description:2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one, with the CAS number 1008-30-6, is a heterocyclic organic compound characterized by its triazole ring structure. This compound features a phenyl group attached to the triazole, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the triazole moiety imparts potential biological activity, making it of interest in pharmaceutical and agricultural applications. Its structure allows for various chemical reactions, including substitution and oxidation, which can be exploited in synthetic chemistry. Additionally, the compound may exhibit specific interactions with biological targets, leading to potential uses in drug development or as a fungicide. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one is a versatile compound with significant implications in various fields of research.

Formula:C₈H₇N₃O

InChI:InChI=1S/C8H7N3O/c12-8-10-9-6-11(8)7-4-2-1-3-5-7/h1-6H,(H,10,12)

InChI key:InChIKey=UYVVGXZLFHZTKT-UHFFFAOYSA-N

SMILES:O=C1NN=CN1C=2C=CC=CC2

Synonyms:
3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl-
4-phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one
NSC 93434
Δ<sup>2</sup>-1,2,4-Triazolin-5-one, 4-phenyl-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl- REF: IN-DA0002WLCAS: 1008-30-6	95%	56.00 €~534.00 €	Tue 04 Mar 25
4-phenyl-4,5-dihydro-1H-1,2,4-triazol-5-one REF: 10-F601398CAS: 1008-30-6	97%	80.00 €~1,017.00 €	Wed 05 Mar 25
2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one REF: 54-OR15507CAS: 1008-30-6	By hplc: 99% by area (Typical Value in Batch COA)	To inquire	Tue 11 Mar 25
4-Phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one REF: 3D-BAA00830CAS: 1008-30-6	Min. 95%	To inquire	Tue 15 Apr 25