CAS 1008-30-6
:2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one
Description:
2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one, with the CAS number 1008-30-6, is a heterocyclic organic compound characterized by its triazole ring structure. This compound features a phenyl group attached to the triazole, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols. The presence of the triazole moiety imparts potential biological activity, making it of interest in pharmaceutical and agricultural applications. Its structure allows for various chemical reactions, including substitution and oxidation, which can be exploited in synthetic chemistry. Additionally, the compound may exhibit specific interactions with biological targets, leading to potential uses in drug development or as a fungicide. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one is a versatile compound with significant implications in various fields of research.
Formula:C8H7N3O
InChI:InChI=1/C8H7N3O/c12-8-10-9-6-11(8)7-4-2-1-3-5-7/h1-6H,(H,10,12)
InChI key:InChIKey=UYVVGXZLFHZTKT-UHFFFAOYSA-N
SMILES:O=C1N(C=NN1)C2=CC=CC=C2
Synonyms:- 3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl-
- 4-phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one
- NSC 93434
- Δ<sup>2</sup>-1,2,4-Triazolin-5-one, 4-phenyl-
- 2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one
- Δ2-1,2,4-Triazolin-5-one, 4-phenyl-
- 4,5-Dihydro-5-oxo-4-phenyl-1H-1,2,4-triazole, (1,5-Dihydro-5-oxo-4H-1,2,4-triazol-4-yl)benzene
- 4-phenyl-1H-1,2,4-triazol-5-one
- 4-Phenyl-1H-1,2,4-triazol-5(4H)-one
- 4-phenyl-4,5-dihydro-1H-1,2,4-triazol-5-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-phenyl-
CAS:Formula:C8H7N3OPurity:95%Color and Shape:SolidMolecular weight:161.16072,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-one
CAS:2,4-Dihydro-4-phenyl-3H-1,2,4-triazol-3-oneFormula:C8H7N3OPurity:≥95%Color and Shape:Solid-PowderMolecular weight:161.160674-Phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one
CAS:4-Phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one is a drug that blocks the L type calcium channel. It has been shown to be effective against cervical cancer and cardiac arrhythmias. This drug binds to the l type calcium channels in tumor cells and prevents the influx of calcium ions into the cell, which would normally cause an increase in intracellular levels of cAMP and activation of protein kinase A. 4PHT is a piperazine derivative with an additional triazole group at position 2. It is an amine blocker that can also affect contractility by inhibiting phosphorylation of myosin light chains.Formula:C8H7N3OPurity:Min. 95%Molecular weight:161.16 g/mol



