CymitQuimica logo

CAS 1008-35-1

:

tetrahydropterin

Description:
Tetrahydropterin, also known as 5,6,7,8-tetrahydrobiopterin (BH4), is a naturally occurring pteridine derivative that plays a crucial role as a cofactor in various enzymatic reactions, particularly in the synthesis of neurotransmitters such as serotonin, dopamine, and norepinephrine. It is characterized by its ability to donate electrons, which is essential for the activity of several enzymes, including phenylalanine hydroxylase and nitric oxide synthase. Tetrahydropterin is a white to off-white crystalline powder that is soluble in water and has a relatively low molecular weight. Its stability can be affected by light and pH, necessitating careful handling and storage conditions. Clinically, tetrahydropterin is significant in the treatment of phenylketonuria (PKU) and other disorders related to neurotransmitter deficiencies. Additionally, it has been studied for its potential therapeutic effects in various neurological and cardiovascular conditions due to its role in nitric oxide production and vascular function.
Formula:C6H9N5O
InChI:InChI=1/C6H9N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h8H,1-2H2,(H4,7,9,10,11,12)
SMILES:C1CNc2c(c(nc(=N)[nH]2)O)N1
Synonyms:
  • 4(1H)-Pteridinone, 2-amino-5,6,7,8-tetrahydro-
  • 2-amino-5,6,7,8-tetrahydropteridin-4(1H)-one
  • Tetrahydropterin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.