CAS 1008-50-0
:4,5,6,7-Tetrahydro-1,2-benzisoxazole-3-carboxamide
Description:
4,5,6,7-Tetrahydro-1,2-benzisoxazole-3-carboxamide, with the CAS number 1008-50-0, is a heterocyclic organic compound characterized by its bicyclic structure that includes a benzene ring fused to an isoxazole moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is indicative of its functional groups. The presence of the carboxamide group contributes to its potential as a polar molecule, influencing its reactivity and interaction with biological systems. It may exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's structure allows for various chemical modifications, which can enhance its biological activity or alter its physicochemical properties. Additionally, its stability under standard conditions and its relatively low toxicity profile make it suitable for further research and potential applications in drug development or as a biochemical tool. As with any chemical substance, proper handling and safety measures should be observed due to its potential biological effects.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c9-8(11)7-5-3-1-2-4-6(5)12-10-7/h1-4H2,(H2,9,11)
InChI key:InChIKey=VJCUMKTYSGYTGO-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C2=C(ON1)CCCC2
Synonyms:- 1,2-Benzisoxazole-3-carboxamide, 4,5,6,7-tetrahydro-
- 4,5,6,7-Tetrahydro-1,2-benzisoxazole-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
