
CAS 1008-99-7
:1,2-Diazidobenzene
Description:
1,2-Diazidobenzene, with the CAS number 1008-99-7, is an organic compound characterized by the presence of two azide (-N3) functional groups attached to a benzene ring at the 1 and 2 positions. This compound is known for its high reactivity and potential explosiveness due to the azide groups, which are known to be sensitive to heat, shock, and friction. The molecular structure contributes to its unique properties, making it a subject of interest in various fields, including materials science and organic synthesis. 1,2-Diazidobenzene is typically a crystalline solid at room temperature and may exhibit a yellow to orange coloration. Its synthesis often involves the nitration of benzene followed by a series of reactions to introduce the azide groups. Due to its hazardous nature, handling and storage require strict safety precautions to prevent accidental detonation. Additionally, its applications may include use in the development of energetic materials or as a precursor in organic synthesis, although its use is limited due to safety concerns.
Formula:C6H4N6
InChI:InChI=1S/C6H4N6/c7-11-9-5-3-1-2-4-6(5)10-12-8/h1-4H
InChI key:InChIKey=IKLDJIXGIQCFFQ-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=C(N=[N+]=[N-])C=CC=C1
Synonyms:- Benzene, 1,2-diazido-
- o-Phenylene diazide
- 1,2-Diazidobenzene
- Benzene, o-diazido-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
