CAS 1008068-91-4

N-[(3,4-Dimethylphenyl)sulfonyl]threonine

Description:

N-[(3,4-Dimethylphenyl)sulfonyl]threonine is a chemical compound characterized by its sulfonamide functional group, which is linked to a threonine amino acid. This compound features a 3,4-dimethylphenyl group, contributing to its unique properties and potential biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. Threonine, an essential amino acid, plays a crucial role in protein synthesis and metabolic processes, making this compound of interest in biochemical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring, which may affect its pharmacokinetic properties. Overall, N-[(3,4-Dimethylphenyl)sulfonyl]threonine represents a class of compounds that could be explored for therapeutic applications, although specific biological activities would require further investigation.

Formula: C₁₂H₁₇NO₅S

InChI: InChI=1S/C12H17NO5S/c1-7-4-5-10(6-8(7)2)19(17,18)13-11(9(3)14)12(15)16/h4-6,9,11,13-14H,1-3H3,(H,15,16)

InChI key: InChIKey=OYGCRHLXODFVBW-UHFFFAOYSA-N

SMILES: S(NC(C(C)O)C(O)=O)(=O)(=O)C1=CC(C)=C(C)C=C1

Synonyms:

• N-[(3,4-Dimethylphenyl)sulfonyl]threonine
• Threonine, N-[(3,4-dimethylphenyl)sulfonyl]-