CAS 1008119-83-2
:3,4-Dimethoxy-N-[4-(3-nitrophenyl)-5-(1-piperidinylmethyl)-2-thiazolyl]benzenesulfonamide
Description:
3,4-Dimethoxy-N-[4-(3-nitrophenyl)-5-(1-piperidinylmethyl)-2-thiazolyl]benzenesulfonamide is a complex organic compound characterized by its multi-functional structure, which includes a sulfonamide group, methoxy substituents, and a thiazole ring. The presence of the nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The piperidinylmethyl moiety may enhance the compound's solubility and bioavailability. This compound is likely to exhibit specific physicochemical properties, such as solubility in organic solvents and moderate stability under standard laboratory conditions. Its molecular structure indicates potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of electron-withdrawing groups, like the nitro group, may influence its reactivity and biological activity. Overall, this compound represents a significant interest in research areas such as drug design and development, particularly for targeting specific biological pathways.
Formula:C23H26N4O6S2
InChI:InChI=1S/C23H26N4O6S2/c1-32-19-10-9-18(14-20(19)33-2)35(30,31)25-23-24-22(16-7-6-8-17(13-16)27(28)29)21(34-23)15-26-11-4-3-5-12-26/h6-10,13-14H,3-5,11-12,15H2,1-2H3,(H,24,25)
InChI key:InChIKey=AOZLMMDVJOGGEQ-UHFFFAOYSA-N
SMILES:C(C1=C(N=C(NS(=O)(=O)C2=CC(OC)=C(OC)C=C2)S1)C3=CC(N(=O)=O)=CC=C3)N4CCCCC4
Synonyms:- 3,4-Dimethoxy-N-[4-(3-nitrophenyl)-5-(1-piperidinylmethyl)-2-thiazolyl]benzenesulfonamide
- JM 6 (enzyme inhibitor)
- Benzenesulfonamide, 3,4-dimethoxy-N-[4-(3-nitrophenyl)-5-(1-piperidinylmethyl)-2-thiazolyl]-
- 3,4-Dimethoxy-N-[4-(3-nitrophenyl)-5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]benzenesulfonamide
- JM 6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-diMethoxy-N-(4-(3-nitrophenyl)-5-(piperidin-1-ylMethyl)thiazol-2-yl)benzenesulfonaMide
CAS:Formula:C23H26N4O6S2Molecular weight:518.6057JM6
CAS:JM6 is a weak kynurenine 3-monooxygenase (KMO) inhibitor that acts on mouse KMO (IC50: 19.85 μM). JM6 can be used to study Alzheimer's disease.Formula:C23H26N4O6S2Color and Shape:SolidMolecular weight:518.61

