CAS 10082-93-6

N-5H-purin-6-ylglycine

Description:

N-5H-purin-6-ylglycine, also known as 6-aminopurine riboside or 6-AP, is a purine derivative characterized by its structure, which includes a purine base linked to a glycine moiety. This compound is notable for its role in various biochemical processes, particularly in plant physiology, where it acts as a cytokinin, promoting cell division and growth. It is a white to off-white crystalline solid that is soluble in water and exhibits moderate stability under standard conditions. The presence of the amino group at the 6-position of the purine ring contributes to its reactivity and biological activity. N-5H-purin-6-ylglycine is often studied for its potential applications in agriculture and biotechnology, particularly in enhancing plant growth and development. Additionally, its interactions with various enzymes and receptors make it a subject of interest in pharmacological research. As with many purine derivatives, it may also exhibit nucleic acid-like properties, influencing genetic and metabolic pathways in living organisms.

Formula: C₇H₇N₅O₂

InChI: InChI=1/C7H7N5O2/c13-4(14)1-8-6-5-7(10-2-9-5)12-3-11-6/h2-3,5H,1H2,(H,13,14)(H,8,9,10,11,12)

SMILES: C(C(=O)O)N=C1C2C(=NC=N2)NC=N1

(9H-Purin-6-ylamino)-acetic acid

CAS: 10082-93-6

Formula: C₇H₇N₅O₂

Purity: 95.0%

Molecular weight: 193.166

Ref: 10-F494451

(9H-Purin-6-ylamino)acetic Acid (may contain up to 20% of inorganics)

CAS: 10082-93-6

Applications (9H-Purin-6-ylamino)-acetic acid (cas# 10082-93-6) is a useful research chemical.

Formula: C₇H₇N₅O₂

Color and Shape: Neat

Molecular weight: 193.163

Ref: TR-P840293

(9H-Purin-6-ylamino)-acetic acid

CAS: 10082-93-6

9H-Purin-6-ylamino)-acetic acid is a cytokinin that can be found in plants such as fruits. It has been found to have biological activity, with the ability to inhibit cell growth and induce differentiation. 9H-Purin-6-ylamino)-acetic acid is an endogenous compound that is synthesized from purine and ribosylzeatin. This compound has been shown to inhibit the oxidation of purines, which results in the production of biologically active metabolites.

Formula: C₇H₇N₅O₂

Purity: Min. 95%

Molecular weight: 193.16 g/mol

Ref: 3D-KAA08293