CymitQuimica logo

CAS 100823-00-5

:

2-[2,6-Bis(1-methylethyl)phenyl]-5-nitro-1H-isoindole-1,3(2H)-dione

Description:
2-[2,6-Bis(1-methylethyl)phenyl]-5-nitro-1H-isoindole-1,3(2H)-dione, with the CAS number 100823-00-5, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core substituted with a nitro group and a bulky bis(1-methylethyl)phenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large hydrophobic groups. Its molecular structure suggests potential applications in organic synthesis, possibly as an intermediate in the production of dyes or pharmaceuticals. The presence of the nitro group may impart specific reactivity, making it a candidate for further chemical transformations. Additionally, the compound's stability under standard conditions is generally expected, although specific handling precautions should be observed due to the presence of the nitro group, which can be sensitive to reduction reactions. Overall, this compound exemplifies the diverse chemistry of isoindole derivatives and their potential utility in various chemical applications.
Formula:C20H20N2O4
InChI:InChI=1S/C20H20N2O4/c1-11(2)14-6-5-7-15(12(3)4)18(14)21-19(23)16-9-8-13(22(25)26)10-17(16)20(21)24/h5-12H,1-4H3
InChI key:InChIKey=RLDVEPIZIKRKPK-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(C(C)C)=CC=C1)N2C(=O)C=3C(C2=O)=CC=C(N(=O)=O)C3
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-[2,6-bis(1-methylethyl)phenyl]-5-nitro-
  • 2-[2,6-Bis(1-methylethyl)phenyl]-5-nitro-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.