CymitQuimica logo

CAS 100827-77-8

:

methyl 3-{5-amino-4-[(2-chlorophenyl)carbonyl]thiophen-2-yl}propanoate

Description:
Methyl 3-{5-amino-4-[(2-chlorophenyl)carbonyl]thiophen-2-yl}propanoate, with the CAS number 100827-77-8, is a chemical compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a methyl ester functional group. This compound features a propanoate backbone, which contributes to its ester properties, making it potentially useful in various chemical reactions, including esterification and nucleophilic substitutions. The presence of the 2-chlorophenyl group indicates that it may exhibit specific biological activities or interactions, possibly enhancing its pharmacological properties. The amino group can participate in hydrogen bonding, influencing its solubility and reactivity. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further explored through spectroscopic methods and biological assays to determine its efficacy and safety in relevant applications.
Formula:C15H14ClNO3S
InChI:InChI=1/C15H14ClNO3S/c1-20-13(18)7-6-9-8-11(15(17)21-9)14(19)10-4-2-3-5-12(10)16/h2-5,8H,6-7,17H2,1H3
SMILES:COC(=O)CCc1cc(C(=O)c2ccccc2Cl)c(N)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.