CAS 100827-79-0
:methyl 3-{5-[(bromoacetyl)amino]-4-[(2-chlorophenyl)carbonyl]thiophen-2-yl}propanoate
Description:
Methyl 3-{5-[(bromoacetyl)amino]-4-[(2-chlorophenyl)carbonyl]thiophen-2-yl}propanoate, with the CAS number 100827-79-0, is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring, a bromoacetyl group, and a chlorophenyl carbonyl moiety. This compound typically exhibits properties associated with both thiophene derivatives and halogenated organic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of electrophilic sites. The bromoacetyl group can participate in nucleophilic substitution reactions, while the carbonyl functionalities may engage in various chemical transformations, including condensation and addition reactions. Its biological activity may be influenced by the presence of the halogen and the thiophene ring, which are known to impart pharmacological properties. As with many synthetic compounds, safety data should be consulted, as it may pose hazards typical of halogenated and reactive organic substances. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and material science.
Formula:C17H15BrClNO4S
InChI:InChI=1/C17H15BrClNO4S/c1-24-15(22)7-6-10-8-12(17(25-10)20-14(21)9-18)16(23)11-4-2-3-5-13(11)19/h2-5,8H,6-7,9H2,1H3,(H,20,21)
SMILES:COC(=O)CCc1cc(C(=O)c2ccccc2Cl)c(N=C(CBr)O)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromoacetylamino-3-(2-chlorobenzoyl)-5-(2-carbomethoxyethyl)thiophene
CAS:Formula:C17H15BrClNO4SColor and Shape:SolidMolecular weight:444.72732-Bromoacetylamino-3-(2-chlorobenzoyl)-5-(2-carbomethoxyethyl)thiophene
CAS:Controlled ProductApplications Intermediate in the preparation of platelet-activating factor (PAF) antagonists
References Bechtel, W.D., et al.: J. Pharm. Sci., 74, 1265 (1985),Formula:C17H15BrClNO4SColor and Shape:NeatMolecular weight:444.73

