CAS 100827-83-6
:methyl 3-[4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-2-yl]propanoate
Description:
Methyl 3-[4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-2-yl]propanoate, with CAS number 100827-83-6, is a complex organic compound characterized by its unique structural features, including a thieno[3,2-f] ring system and a diazepine moiety. This compound exhibits a combination of heterocyclic structures, which contribute to its potential biological activity. The presence of a chlorophenyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its methyl ester functionality indicates that it may undergo hydrolysis to yield the corresponding carboxylic acid, which could influence its pharmacokinetic properties. The compound's solubility, stability, and reactivity are likely influenced by its intricate molecular architecture. As with many such compounds, its synthesis and characterization would require careful analytical techniques, including NMR, mass spectrometry, and possibly X-ray crystallography, to confirm its structure and purity. Overall, this compound represents a class of molecules that may have applications in drug development or other chemical research fields.
Formula:C19H17ClN4O2S
InChI:InChI=1/C19H17ClN4O2S/c1-11-22-23-16-10-21-18(13-5-3-4-6-15(13)20)14-9-12(7-8-17(25)26-2)27-19(14)24(11)16/h3-6,9H,7-8,10H2,1-2H3
SMILES:Cc1nnc2CN=C(c3ccccc3Cl)c3cc(CCC(=O)OC)sc3n12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6H-Thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-propanoic acid, 4-(2-chlorophenyl)-9-methyl-, methyl ester
CAS:Formula:C19H17ClN4O2SColor and Shape:SolidMolecular weight:400.88194-(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-propanoic Acid Methyl Ester
CAS:Controlled Product<p>Applications Brotizolam derivative; a thienotriazolodiazepines as platelet activating factor antagonist.<br>References Bechtel, W.D., et al.: J. Pharm. Sci., 74, 1265 (1985),<br></p>Formula:C19H17ClN4O2SColor and Shape:NeatMolecular weight:400.884-(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-propanoic acid methyl ester
CAS:Controlled Product<p>Please enquire for more information about 4-(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine-2-propanoic acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C19H17ClN4O2SPurity:Min. 95%Molecular weight:400.88 g/mol


