CymitQuimica logo

CAS 1008304-82-2

:

N-(2-Fluoroethyl)glycine

Description:
N-(2-Fluoroethyl)glycine is an organic compound characterized by the presence of a glycine backbone with a fluoroethyl substituent. Its molecular structure features an amino group, a carboxylic acid group, and a fluorinated ethyl group, which contributes to its unique chemical properties. This compound is typically classified as an amino acid derivative, and its fluorinated nature may impart distinct biological activity or influence its interaction with biological systems. The presence of the fluorine atom can enhance lipophilicity and alter the compound's reactivity compared to non-fluorinated analogs. N-(2-Fluoroethyl)glycine may be of interest in medicinal chemistry and drug design, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various research applications, including studies on amino acid metabolism or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the potential reactivity of fluorinated compounds.
Formula:C4H8FNO2
InChI:InChI=1S/C4H8FNO2/c5-1-2-6-3-4(7)8/h6H,1-3H2,(H,7,8)
InChI key:InChIKey=XMOFVHLIHKQOLE-UHFFFAOYSA-N
SMILES:C(NCCF)C(O)=O
Synonyms:
  • Glycine, N-(2-fluoroethyl)-
  • 2-[(2-Fluoroethyl)amino]acetic acid
  • N-(2-Fluoroethyl)glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.