CAS 100831-20-7
:4-(TRIFLUOROMETHYL)-2(3H)-BENZOTHIAZOLONE
Description:
4-(Trifluoromethyl)-2(3H)-benzothiazolone is a chemical compound characterized by its unique structure, which includes a benzothiazolone moiety substituted with a trifluoromethyl group. This compound typically exhibits properties such as high stability and solubility in organic solvents, making it useful in various chemical applications. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity, often making it a candidate for use in pharmaceuticals, agrochemicals, and materials science. Additionally, benzothiazolone derivatives are known for their potential biological activities, including antimicrobial and anti-inflammatory properties. The compound's molecular structure contributes to its electronic properties, which can be exploited in dye synthesis and as a fluorescent probe in analytical chemistry. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence. Overall, 4-(trifluoromethyl)-2(3H)-benzothiazolone is a versatile compound with significant implications in various fields of research and industry.
Formula:C8H4F3NOS
InChI:InChI=1/C8H4F3NOS/c9-8(10,11)4-2-1-3-5-6(4)12-7(13)14-5/h1-3H,(H,12,13)
SMILES:c1cc(c2c(c1)sc(n2)O)C(F)(F)F
Synonyms:- 2(3H)-Benzothiazolone,4-(trifluoromethyl)-(9CI)
- 4-(trifluoromethyl)-3H-1,3-benzothiazol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
