CAS 1008361-79-2

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-3-carboxaldehyde

Description:

5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-3-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene moiety and a dioxaborolane group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in organic synthesis and materials science. The presence of the carboxaldehyde functional group suggests reactivity that can facilitate further chemical transformations, such as condensation reactions or nucleophilic additions. The dioxaborolane unit is known for its role in boron chemistry, particularly in cross-coupling reactions, making this compound potentially useful in the development of pharmaceuticals or advanced materials. Additionally, the tetramethyl substitution enhances its stability and solubility in organic solvents. Overall, this compound's structural features and functional groups position it as a versatile intermediate in various chemical applications.

Formula: C₁₅H₁₇BO₃S

InChI: InChI=1S/C15H17BO3S/c1-14(2)15(3,4)19-16(18-14)11-5-6-13-12(7-11)10(8-17)9-20-13/h5-9H,1-4H3

InChI key: InChIKey=RRIODKDVZIEEGE-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=CC=C(C2)B3OC(C)(C)C(C)(C)O3)SC1

Synonyms:

• Benzo[b]thiophene-3-carboxaldehyde, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-3-carboxaldehyde
• 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-3-carboxaldehyde