CAS 100840-64-0

1-Propanamine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)

Description:

1-Propanamine, 3-(4-nitrophenoxy)-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a nitrophenoxy substituent. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound features a propanamine backbone, which contributes to its basicity and potential reactivity in various chemical reactions. The 4-nitrophenoxy group introduces electron-withdrawing characteristics, influencing the compound's reactivity and interaction with other chemical species. This compound may be utilized in various applications, including pharmaceuticals and chemical synthesis, owing to its unique structural properties. Safety data sheets should be consulted for handling and storage guidelines, as amines can be hazardous. Overall, 1-Propanamine, 3-(4-nitrophenoxy)-, hydrochloride is a notable compound in organic chemistry with specific characteristics that make it suitable for various research and industrial applications.

Formula: C₉H₁₂N₂O₃·ClH

InChI: InChI=1S/C9H12N2O3.ClH/c10-6-1-7-14-9-4-2-8(3-5-9)11(12)13;/h2-5H,1,6-7,10H2;1H

InChI key: InChIKey=BLCCRXVDPAKRKB-UHFFFAOYSA-N

SMILES: O(CCCN)C1=CC=C(N(=O)=O)C=C1.Cl

Synonyms:

• 1-Propanamine, 3-(4-nitrophenoxy)-, monohydrochloride
• 1-Propanamine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)