CymitQuimica logo

CAS 1008428-33-8

:

3-(2-Furanyl)-1H-pyrazole-4-carbonitrile

Description:
3-(2-Furanyl)-1H-pyrazole-4-carbonitrile is an organic compound characterized by its unique structural features, which include a pyrazole ring and a furan moiety. The presence of the cyano group (-C≡N) at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits a moderate to high polarity due to the electronegative nitrogen and cyano groups, influencing its solubility in polar solvents. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry. The furan ring can participate in various chemical transformations, enhancing the compound's versatility. Additionally, its molecular structure allows for potential interactions with biological targets, which could lead to the development of novel pharmaceuticals. Overall, 3-(2-Furanyl)-1H-pyrazole-4-carbonitrile is a compound of interest in both synthetic and medicinal chemistry due to its distinctive features and potential applications.
Formula:C8H5N3O
InChI:InChI=1S/C8H5N3O/c9-4-6-5-10-11-8(6)7-2-1-3-12-7/h1-3,5H,(H,10,11)
InChI key:InChIKey=PHVYQUUVFIYOEH-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=NNC1)C2=CC=CO2
Synonyms:
  • 3-(2-Furanyl)-1H-pyrazole-4-carbonitrile
  • 1H-Pyrazole-4-carbonitrile, 3-(2-furanyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.