CAS 100846-28-4

3,3′,5,5′-Tetrachloro-2,2′-bipyridine

Description:

3,3′,5,5′-Tetrachloro-2,2′-bipyridine, with the CAS number 100846-28-4, is a synthetic organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of four chlorine atoms at the 3 and 5 positions of both rings significantly enhances its chemical stability and lipophilicity. This compound is typically a solid at room temperature and is known for its low solubility in water, making it more soluble in organic solvents. It exhibits potential applications in various fields, including agriculture as a pesticide or herbicide, due to its ability to interact with biological systems. Additionally, its chlorinated structure may contribute to its effectiveness in certain chemical reactions or as a ligand in coordination chemistry. However, the environmental persistence and potential toxicity of chlorinated compounds necessitate careful handling and assessment of their ecological impact. Overall, 3,3′,5,5′-Tetrachloro-2,2′-bipyridine is a notable compound in the realm of synthetic organic chemistry.

Formula: C₁₀H₄Cl₄N₂

InChI: InChI=1S/C10H4Cl4N2/c11-5-1-7(13)9(15-3-5)10-8(14)2-6(12)4-16-10/h1-4H

InChI key: InChIKey=LBWLQILBBQSTFR-UHFFFAOYSA-N

SMILES: ClC1=C(N=CC(Cl)=C1)C2=C(Cl)C=C(Cl)C=N2

Synonyms:

• 3,3′,5,5′-Tetrachloro-2,2′-bipyridine
• 2,2′-Bipyridine, 3,3′,5,5′-tetrachloro-