CymitQuimica logo

CAS 1008517-74-5

:

5-Hydroxy-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone

Description:
5-Hydroxy-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone is a chemical compound characterized by its unique structural features, which include a pyridazinone core and a tetrahydropyran substituent. This compound typically exhibits properties such as solubility in polar solvents, which is common for compounds containing hydroxyl groups and heterocycles. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. Additionally, the tetrahydropyran moiety may impart certain steric and electronic effects, affecting the compound's overall stability and biological activity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a class of heterocyclic compounds that may have significant applications in drug development and other chemical research fields.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c12-7-5-8(13)11(10-6-7)9-3-1-2-4-14-9/h5-6,9,12H,1-4H2
InChI key:InChIKey=FYBANGAAMWXVEU-UHFFFAOYSA-N
SMILES:O=C1N(C2CCCCO2)N=CC(O)=C1
Synonyms:
  • 5-Hydroxy-2-(tetrahydro-2H-pyran-2-yl)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 5-hydroxy-2-(tetrahydro-2H-pyran-2-yl)-
  • 5-Hydroxy-2-(tetrahydro-2H-pyran-2-yl)pyridazin-3(2H)-one
  • 5-Hydroxy-2-(2-tetrahydropyranyl)pyridazin-3(2H)-one
  • 5-Hydroxy-2-(tetrahydro-pyran-2-yl)-2H-pyridazin-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.