CAS 1008675-45-3: 1-(4-Quinazolinyl)proline

Description:1-(4-Quinazolinyl)proline is a chemical compound characterized by its unique structure, which combines a proline moiety with a quinazoline ring. This compound typically exhibits properties associated with both amino acids and heterocyclic aromatic compounds. It is often studied for its potential biological activities, particularly in medicinal chemistry, due to the presence of the quinazoline moiety, which is known for its diverse pharmacological properties, including anti-cancer and anti-inflammatory effects. The proline component contributes to its ability to interact with biological systems, potentially influencing protein folding and enzyme activity. In terms of solubility, it may exhibit moderate solubility in polar solvents, while its stability can be influenced by environmental factors such as pH and temperature. The compound's molecular interactions and reactivity can be further explored through various analytical techniques, making it a subject of interest in drug design and development. Overall, 1-(4-Quinazolinyl)proline represents a fascinating intersection of organic chemistry and pharmacology.

Formula:C₁₃H₁₃N₃O₂

InChI:InChI=1S/C13H13N3O2/c17-13(18)11-6-3-7-16(11)12-9-4-1-2-5-10(9)14-8-15-12/h1-2,4-5,8,11H,3,6-7H2,(H,17,18)

InChI key:InChIKey=GFUFVXIKRWWWKO-UHFFFAOYSA-N

SMILES:O=C(O)C1N(C=2N=CN=C3C=CC=CC32)CCC1

Synonyms:
1-(4-Quinazolinyl)proline
Proline, 1-(4-quinazolinyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1-(Quinazolin-4-yl)pyrrolidine-2-carboxylic acid REF: 10-F658501CAS: 1008675-45-3	97%	- - -	Discontinued product
	1-(Quinazolin-4-yl)pyrrolidine-2-carboxylic acid REF: 3D-IQB67545CAS: 1008675-45-3	Min. 95%	- - -	Discontinued product