CAS 100868-79-9

N-(3-Methylphenyl)sulfamide

Description:

N-(3-Methylphenyl)sulfamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a 3-methylphenyl moiety. This compound features a sulfonamide linkage, which consists of a sulfur atom bonded to an oxygen atom and a nitrogen atom, with the nitrogen further connected to a phenyl group that has a methyl substituent at the meta position. The presence of the methyl group influences the compound's physical and chemical properties, such as solubility and reactivity. N-(3-Methylphenyl)sulfamide may exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methyl group and the overall molecular structure. As with many sulfonamides, it may also exhibit properties such as antibacterial activity, although specific biological effects would require further investigation. Safety and handling considerations should be observed, as with all chemical substances.

Formula: C₇H₁₀N₂O₂S

InChI: InChI=1S/C7H10N2O2S/c1-6-3-2-4-7(5-6)9-12(8,10)11/h2-5,9H,1H3,(H2,8,10,11)

InChI key: InChIKey=XIAGCJUEEYGHNL-UHFFFAOYSA-N

SMILES: N(S(N)(=O)=O)C1=CC(C)=CC=C1

Synonyms:

• Sulfamide, N-(3-methylphenyl)-
• N-(3-Methylphenyl)sulfamide
• Sulfamide, m-tolyl-