CAS 100869-87-2
:5,6,7,8-Tetrahydro-2-phenylquinazoline
Description:
5,6,7,8-Tetrahydro-2-phenylquinazoline is a bicyclic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring system. This compound features a tetrahydro structure, indicating the presence of four hydrogen-saturated carbon atoms, which contributes to its stability and solubility in organic solvents. The phenyl group attached to the quinazoline structure enhances its aromatic character and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the presence of nitrogen atoms in the quinazoline ring can participate in hydrogen bonding, which is crucial for binding interactions in biological systems. Overall, 5,6,7,8-Tetrahydro-2-phenylquinazoline is a versatile compound with significant implications in pharmaceutical research.
Formula:C14H14N2
InChI:InChI=1S/C14H14N2/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-3,6-7,10H,4-5,8-9H2
InChI key:InChIKey=MNLWAQLJGDBVDU-UHFFFAOYSA-N
SMILES:C=1(N=C2C(=CN1)CCCC2)C3=CC=CC=C3
Synonyms:- Quinazoline, 5,6,7,8-tetrahydro-2-phenyl-
- 5,6,7,8-Tetrahydro-2-phenylquinazoline
- 2-Phenyl-5,6,7,8-tetrahydroquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
