
CAS 10087-89-5
:Enpromate
Description:
Enpromate, with the CAS number 10087-89-5, is a chemical compound primarily recognized for its application in the field of pharmaceuticals and as a potential therapeutic agent. It is characterized by its molecular structure, which includes specific functional groups that contribute to its biological activity. Enpromate is often studied for its interactions with biological systems, particularly in relation to its efficacy and safety profiles. The compound may exhibit properties such as solubility in various solvents, stability under certain conditions, and specific reactivity with other chemical entities. Its pharmacological effects are of particular interest, as they can influence its use in medical applications. Additionally, the compound's synthesis and purification processes are crucial for obtaining it in a form suitable for research and development. Overall, Enpromate represents a significant subject of study within medicinal chemistry, with ongoing research aimed at elucidating its full potential and mechanisms of action.
Formula:C22H23NO2
InChI:InChI=1S/C22H23NO2/c1-2-22(18-12-6-3-7-13-18,19-14-8-4-9-15-19)25-21(24)23-20-16-10-5-11-17-20/h1,3-4,6-9,12-15,20H,5,10-11,16-17H2,(H,23,24)
InChI key:InChIKey=NBEALWAVEGMZQY-UHFFFAOYSA-N
SMILES:C(OC(NC1CCCCC1)=O)(C#C)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 2-Propyn-1-ol, 1,1-diphenyl-, cyclohexylcarbamate
- Carbamic acid, N-cyclohexyl-, 1,1-diphenyl-2-propyn-1-yl ester
- Carbamic acid, cyclohexyl-, 1,1-diphenyl-2-propynyl ester
- 2-Propyn-1-ol, 1,1-diphenyl-, cyclohexanecarbamate
- Cyclohexanecarbamic acid, 1,1-diphenyl-2-propynyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Enpromate
CAS:Enpromate is a synthetic acetyl carbamate, nitrogen mustard compound. It is an alkylating agent with antitumor activity.Formula:C22H23NO2Color and Shape:SolidMolecular weight:333.42
