CymitQuimica logo

CAS 1008780-89-9

:

2-Bromo-2-methyl-N-2-propen-1-ylpropanamide

Description:
2-Bromo-2-methyl-N-2-propen-1-ylpropanamide is an organic compound characterized by its unique structure, which includes a bromine atom, a methyl group, and an amide functional group. This compound features a branched alkyl chain and a double bond in the propenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and boiling point. Typically, compounds like this may exhibit moderate to high polarity due to the presence of the amide, affecting their interactions with solvents. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where specific reactivity and functionalization are desired. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-Bromo-2-methyl-N-2-propen-1-ylpropanamide is a versatile compound with significant implications in synthetic chemistry.
Formula:C7H12BrNO
InChI:InChI=1S/C7H12BrNO/c1-4-5-9-6(10)7(2,3)8/h4H,1,5H2,2-3H3,(H,9,10)
InChI key:InChIKey=VJLPAVYWNIYLRU-UHFFFAOYSA-N
SMILES:C(C(Br)(C)C)(NCC=C)=O
Synonyms:
  • Propanamide, 2-bromo-2-methyl-N-2-propen-1-yl-
  • 2-Bromo-2-methyl-N-2-propen-1-ylpropanamide
  • 2-Bromo-2-methyl-N-prop-2-enylpropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.