
CAS 10088-45-6
:Methyl hydrogen P-phenylphosphonate
Description:
Methyl hydrogen P-phenylphosphonate, with the CAS number 10088-45-6, is an organophosphorus compound characterized by its phosphonate functional group. This substance typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It possesses a distinctive aromatic structure due to the phenyl group, which contributes to its chemical stability and reactivity. Methyl hydrogen P-phenylphosphonate is soluble in organic solvents, making it useful in various applications, including as a reagent in organic synthesis and as a potential intermediate in the production of other phosphorus-containing compounds. It exhibits properties typical of phosphonates, such as the ability to form esters and undergo hydrolysis. Additionally, it may have implications in agricultural chemistry and materials science, although safety and handling precautions are essential due to potential toxicity associated with organophosphorus compounds. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C7H9O3P
InChI:InChI=1S/C7H9O3P/c1-10-11(8,9)7-5-3-2-4-6-7/h2-6H,1H3,(H,8,9)
InChI key:InChIKey=ZWBALHRZGYPNNG-UHFFFAOYSA-N
SMILES:P(OC)(=O)(O)C1=CC=CC=C1
Synonyms:- Phosphonic acid, phenyl-, monomethyl ester
- Methyl hydrogen phenylphosphonate
- Methyl hydrogen P-phenylphosphonate
- O-Methyl phenylphosphonate
- Phosphonic acid, P-phenyl-, monomethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
