CAS 100880-62-4

1-[1,1′-Biphenyl]-4-yl-3,5-pyrazolidinedione

Description:

1-[1,1′-Biphenyl]-4-yl-3,5-pyrazolidinedione, identified by its CAS number 100880-62-4, is a chemical compound characterized by its unique structure, which includes a biphenyl moiety and a pyrazolidinedione framework. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its stability and reactivity. It is often studied for its potential biological activities, including anti-inflammatory and analgesic effects, due to the presence of the pyrazolidinedione group. The compound may also display interesting electronic properties owing to the biphenyl structure, which can influence its interactions in various chemical environments. In terms of solubility, it may show varying degrees of solubility in organic solvents, which is common for compounds with large aromatic systems. Additionally, its synthesis and characterization are of interest in medicinal chemistry, where modifications to its structure can lead to derivatives with enhanced pharmacological profiles. Overall, this compound represents a significant area of research in the development of new therapeutic agents.

Formula: C₁₅H₁₂N₂O₂

InChI: InChI=1S/C15H12N2O2/c18-14-10-15(19)17(16-14)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2,(H,16,18)

InChI key: InChIKey=BDELXUMTBCEWAH-UHFFFAOYSA-N

SMILES: O=C1N(NC(=O)C1)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• 1-[1,1′-Biphenyl]-4-yl-3,5-pyrazolidinedione
• 3,5-Pyrazolidinedione, 1-(4-biphenylyl)-
• 3,5-Pyrazolidinedione, 1-[1,1′-biphenyl]-4-yl-

3,5-Pyrazolidinedione, 1-[1,1'-biphenyl]-4-yl-

CAS: 100880-62-4

Formula: C₁₅H₁₂N₂O₂

Molecular weight: 252.268

Ref: IN-DA00033C