CAS 1008857-93-9

Methyl 1-(2-chloroacetyl)decahydro-3-oxo-2-quinoxalineacetate

Description:

Methyl 1-(2-chloroacetyl)decahydro-3-oxo-2-quinoxalineacetate is a synthetic organic compound characterized by its complex structure, which includes a quinoxaline moiety, a decahydro framework, and an ester functional group. The presence of the chloroacetyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit properties typical of quinoxaline derivatives, such as biological activity, including antimicrobial or anticancer effects, due to the heterocyclic nature of the quinoxaline ring. The ester functionality indicates that it can undergo hydrolysis, making it relevant in various chemical reactions and applications. Its solubility and stability would depend on the specific conditions, such as solvent and pH. Additionally, the compound's molecular weight, boiling point, and melting point would be influenced by its structural components. Overall, Methyl 1-(2-chloroacetyl)decahydro-3-oxo-2-quinoxalineacetate represents a class of compounds that may have significant implications in medicinal chemistry and material science.

Formula: C₁₃H₁₉ClN₂O₄

InChI: InChI=1S/C13H19ClN2O4/c1-20-12(18)6-10-13(19)15-8-4-2-3-5-9(8)16(10)11(17)7-14/h8-10H,2-7H2,1H3,(H,15,19)

InChI key: InChIKey=WMSZAZJMNQNIFY-UHFFFAOYSA-N

SMILES: C(CCl)(=O)N1C2C(NC(=O)C1CC(OC)=O)CCCC2

Synonyms:

• 2-Quinoxalineacetic acid, 1-(2-chloroacetyl)decahydro-3-oxo-, methyl ester
• [1-(2-Chloro-acetyl)-3-oxo-decahydro-quinoxalin-2-yl]-acetic acid methyl ester
• Methyl 1-(2-chloroacetyl)decahydro-3-oxo-2-quinoxalineacetate