CAS 1009-57-0

1-(5-amino-4-nitrothiophen-2-yl)ethanone

Description:

1-(5-amino-4-nitrothiophen-2-yl)ethanone, with the CAS number 1009-57-0, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an amino group (-NH2) and a nitro group (-NO2) attached to the thiophene ring, contributing to its reactivity and potential applications in various chemical reactions. The ethanone functional group indicates the presence of a carbonyl (C=O) adjacent to an ethyl group, which can influence the compound's reactivity, particularly in nucleophilic addition reactions. The presence of both amino and nitro groups suggests that this compound may exhibit interesting electronic properties and could be involved in various biological activities. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the thiophene ring, making it a subject of interest in synthetic organic chemistry and potentially in pharmaceutical applications.

Formula: C₆H₆N₂O₃S

InChI: InChI=1/C6H6N2O3S/c1-3(9)5-2-4(8(10)11)6(7)12-5/h2H,7H2,1H3