CAS 1009-67-2
:alpha-methylhydrocinnamic acid
Description:
Alpha-methylhydrocinnamic acid, with the CAS number 1009-67-2, is an aromatic carboxylic acid characterized by its unique structure, which includes a methyl group adjacent to the carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid and is known for its moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water. It exhibits a melting point that is indicative of its crystalline nature. Alpha-methylhydrocinnamic acid is often utilized in organic synthesis and can serve as an intermediate in the production of various pharmaceuticals and fragrances. Its chemical properties include the ability to undergo typical reactions of carboxylic acids, such as esterification and decarboxylation. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Overall, its structural features and reactivity make alpha-methylhydrocinnamic acid a valuable compound in both industrial and research applications.
Formula:C10H11O2
InChI:InChI=1/C10H12O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/p-1/t8-/m1/s1
SMILES:C[C@H](Cc1ccccc1)C(=O)[O-]
Synonyms:- alfa-Methylhydrocinnamic acid
- 2-Phenylbutanoic Acid
- 2-Methyl-3-Phenylpropanoic Acid
- (2S)-2-methyl-3-phenylpropanoate
- (2R)-2-methyl-3-phenylpropanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenepropanoic acid, α-methyl-
CAS:Formula:C10H12O2Purity:95%Color and Shape:SolidMolecular weight:164.20112-Methyl-3-phenylpropanoic acid
CAS:2-Methyl-3-phenylpropanoic acidPurity:98%Molecular weight:164.20g/molα-Methylhydrocinnamic acid
CAS:Alpha-methylhydrocinnamic acid (AMHA) is a synthetic enantiomer of 2-phenylbutyric acid, which has been shown to inhibit the growth of k562 cells. It is also a substrate for fatty acid synthase and may play an important role in fatty acid metabolism. AMHA has been shown to inhibit the production of reactive oxygen species by phagocytic cells exposed to ionizing radiation, which may be due to its ability to scavenge hydroxyl radicals. The effect of AMHA on hematopoietic cells, including neutrophils and bone marrow cells, has not yet been determined.Formula:C10H12O2Purity:Min. 95%Color and Shape:White Clear LiquidMolecular weight:164.2 g/mol2-Methyl-3-phenylpropanoic acid
CAS:Formula:C10H12O2Purity:95%Color and Shape:SolidMolecular weight:164.204



