CAS 1009-70-7
:N-phenyl-4,5-dihydro-1,3-thiazol-2-amine
Description:
N-phenyl-4,5-dihydro-1,3-thiazol-2-amine is an organic compound characterized by its thiazole ring structure, which incorporates both nitrogen and sulfur atoms. This compound features a phenyl group attached to the nitrogen of the thiazole, contributing to its aromatic properties. The presence of the dihydro group indicates that the thiazole ring is partially saturated, which can influence its reactivity and stability. N-phenyl-4,5-dihydro-1,3-thiazol-2-amine is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties make it of interest in various fields, including medicinal chemistry, where thiazole derivatives are often explored for their biological activities. The compound may participate in reactions typical of amines and thiazoles, such as nucleophilic substitutions or cyclization reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C9H10N2S
InChI:InChI=1/C9H10N2S/c1-2-4-8(5-3-1)11-9-10-6-7-12-9/h1-5H,6-7H2,(H,10,11)
SMILES:c1ccc(cc1)NC1=NCCS1
Synonyms:- 2-thiazolamine, 4,5-dihydro-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
