CAS 1009-93-4: 2,2,4,4,6,6-hexamethylcyclotrisilazane
Description:2,2,4,4,6,6-Hexamethylcyclotrisilazane, with CAS number 1009-93-4, is a cyclic silazane compound characterized by its unique structure, which consists of a three-membered silazane ring with six methyl groups attached to the silicon atoms. This compound is known for its thermal stability and resistance to moisture, making it useful in various applications, particularly in the field of silicone chemistry. Its molecular structure imparts properties such as low volatility and high viscosity, which are advantageous in formulations for sealants, adhesives, and coatings. Additionally, 2,2,4,4,6,6-hexamethylcyclotrisilazane exhibits good compatibility with organic solvents and can enhance the mechanical properties of polymer matrices when used as an additive. The presence of nitrogen in its structure contributes to its unique reactivity, allowing it to participate in further chemical reactions, such as polymerization. Overall, this compound is significant in materials science and industrial applications due to its distinctive properties and versatility.
Formula:C6H21N3Si3
InChI:InChI=1S/C6H21N3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H,1-6H3
InChI key:InChIKey=WGGNJZRNHUJNEM-UHFFFAOYSA-N
SMILES:N1[Si](N[Si](N[Si]1(C)C)(C)C)(C)C
- Synonyms:
- 1,1,3,3,5,5-Hexamethylcyclotrisilazane
- 1,2,2,3,4,4-Hexamethyl-1,3,5,2,4,6-Triazatrisilinane
- 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-triazatrisilinane
- 213-773-6
- Cyclotrisilazane, 2,2,4,4,6,6-hexamethyl-
- Hmcts
- NSC 139842
- 2,2,4,4,6,6-Hexamethylcyclotrisilazane
