CAS 100905-33-7
:Benzoic acid, 4,5-dimethoxy-2-nitro-, ethyl ester
Description:
Benzoic acid, 4,5-dimethoxy-2-nitro-, ethyl ester, identified by the CAS number 100905-33-7, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a nitro group and two methoxy groups attached to the benzene ring, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, while the methoxy groups can influence its solubility and polarity. As an ethyl ester, it is likely to exhibit moderate volatility and may have applications in organic synthesis or as an intermediate in the production of other chemical compounds. The structural modifications imparted by the substituents can affect its biological activity, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in various chemical processes.
Formula:C11H13NO6
InChI:InChI=1S/C11H13NO6/c1-4-18-11(13)7-5-9(16-2)10(17-3)6-8(7)12(14)15/h5-6H,4H2,1-3H3
InChI key:InChIKey=VNPCXITWHOOQAJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N(=O)=O)C=C(OC)C(OC)=C1
Synonyms:- 4,5-Dimethoxy-2-nitrobenzoic acid ethyl ester~Ethyl 3,4-dimethoxy-6-nitrobenzoate~Ethyl 6-nitroveratrate
- Benzoic acid, 4,5-dimethoxy-2-nitro-, ethyl ester
- Ethyl 4,5-dimethoxy-2-nitrobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
