CAS 1009075-40-4
:1,1-Dimethylethyl (2R)-2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl (2R)-2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1009075-40-4, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with an ethylamino group and a tert-butyl group. This compound is likely to exhibit properties typical of amines and esters, including potential basicity due to the presence of the amino group and reactivity associated with the carboxylate moiety. The stereochemistry indicated by the (2R) designation suggests that it has specific spatial arrangements that may influence its biological activity and interactions. Such compounds can be of interest in medicinal chemistry, potentially serving as intermediates or active pharmaceutical ingredients. Its solubility, stability, and reactivity would depend on the specific functional groups and their arrangement, making it a candidate for further study in various chemical and biological applications.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-5-13-9-10-7-6-8-14(10)11(15)16-12(2,3)4/h10,13H,5-9H2,1-4H3/t10-/m1/s1
InChI key:InChIKey=RKMARTBPQCEJTJ-SNVBAGLBSA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@@H](CNCC)CCC1
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-[(ethylamino)methyl]-, 1,1-dimethylethyl ester, (2R)-
- (r)-1-Boc-2-(ethylaminomethyl)-pyrrolidine
- 1,1-Dimethylethyl (2R)-2-[(ethylamino)methyl]-1-pyrrolidinecarboxylate
- (R)-tert-Butyl 2-((ethylamino)methyl)pyrrolidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-tert-Butyl 2-((ethylamino)methyl)pyrrolidine-1-carboxylate
CAS:Formula:C12H24N2O2Molecular weight:228.3312
