CAS 100908-62-1
:2-Cyano-3-(m-fluorophenyl)acrylamide
Description:
2-Cyano-3-(m-fluorophenyl)acrylamide is an organic compound characterized by its acrylamide structure, which features a cyano group and a fluorophenyl substituent. This compound typically appears as a solid and is soluble in polar organic solvents. The presence of the cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and nucleophilic addition. The m-fluorophenyl group introduces both electron-withdrawing and steric effects, which can influence the compound's reactivity and interaction with biological systems. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. As with many acrylamide derivatives, caution is advised due to potential toxicity and environmental impact, necessitating appropriate handling and disposal measures in laboratory settings.
Formula:C10H7FN2O
InChI:InChI=1/C10H7FN2O/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-5H,(H2,13,14)/b8-5+
Synonyms:- Cinnamamide, alpha-cyano-3-fluoro-
- 2-(3-Fluorobenzylidene)-2-cyanoacetamide
- 2-Propenamide, 2-cyano-3-(3-fluorophenyl)-
- Acrylamide, 2-cyano-3-(m-fluorophenyl)-
- alpha-Cyano-3-fluorocinnamamide
- (2E)-2-cyano-3-(4-fluorophenyl)prop-2-enamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
