CymitQuimica logo

CAS 100910-67-6

:

1-Amino-1,3-cyclopentanedicarboxylic acid

Description:
1-Amino-1,3-cyclopentanedicarboxylic acid, also known as ACPC, is an amino acid derivative characterized by its cyclopentane ring structure with two carboxylic acid groups and one amino group. This compound is a white crystalline solid that is soluble in water, reflecting its polar functional groups. The presence of both amino and carboxylic acid groups allows it to participate in various chemical reactions, including peptide bond formation, making it relevant in biochemical applications. Its unique cyclic structure contributes to its potential as a chiral building block in organic synthesis. Additionally, ACPC has been studied for its role in neurotransmission and as a potential neuroprotective agent. The compound's properties, such as melting point and pH stability, can vary based on environmental conditions, but it generally exhibits stability under standard laboratory conditions. Overall, 1-Amino-1,3-cyclopentanedicarboxylic acid is notable for its structural features and potential applications in both synthetic and biological chemistry.
Formula:C7H11NO4
InChI:InChI=1S/C7H11NO4/c8-7(6(11)12)2-1-4(3-7)5(9)10/h4H,1-3,8H2,(H,9,10)(H,11,12)
InChI key:InChIKey=YFYNOWXBIBKGHB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)CC(C(O)=O)CC1
Synonyms:
  • 1-Amino-1,3-cyclopentanedicarboxylic acid
  • 1-Aminocyclopentane-1,3-dicarboxylic acid
  • 1,3-Cyclopentanedicarboxylic acid, 1-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.